C10H22N2O3 — CID 66165549
3,3-dimethoxy-2-methyl-2-(2-methylpropylamino)propanamide (PubChem CID 66165549) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is 3,3-dimethoxy-2-methyl-2-(2-methylpropylamino)propanamide.
| Compound Name | 3,3-dimethoxy-2-methyl-2-(2-methylpropylamino)propanamide |
|---|---|
| PubChem CID | 66165549 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 3,3-dimethoxy-2-methyl-2-(2-methylpropylamino)propanamide |
| SMILES | COC(OC)C(C)(NCC(C)C)C(N)=O |
| InChI | InChI=1S/C10H22N2O3/c1-7(2)6-12-10(3,8(11)13)9(14-4)15-5/h7,9,12H,6H2,1-5H3,(H2,11,13) |
| InChIKey | BWSFZLDDZRVVTF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|