C13H28N2O3 — CID 112738116
2-[(3-butoxy-2-hydroxypropyl)amino]-2,3-dimethylbutanamide (PubChem CID 112738116) has the molecular formula C13H28N2O3 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-[(3-butoxy-2-hydroxypropyl)amino]-2,3-dimethylbutanamide.
| Compound Name | 2-[(3-butoxy-2-hydroxypropyl)amino]-2,3-dimethylbutanamide |
|---|---|
| PubChem CID | 112738116 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 2-[(3-butoxy-2-hydroxypropyl)amino]-2,3-dimethylbutanamide |
| SMILES | CCCCOCC(O)CNC(C)(C(N)=O)C(C)C |
| InChI | InChI=1S/C13H28N2O3/c1-5-6-7-18-9-11(16)8-15-13(4,10(2)3)12(14)17/h10-11,15-16H,5-9H2,1-4H3,(H2,14,17) |
| InChIKey | FUYXBRAZAZXKQO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|