C16H34N2O3 — CID 104580494
3-[(2-hydroxy-3-octoxypropyl)amino]-3-methylbutanamide (PubChem CID 104580494) has the molecular formula C16H34N2O3 and a molecular weight of 302.46 g/mol. Its IUPAC name is 3-[(2-hydroxy-3-octoxypropyl)amino]-3-methylbutanamide.
| Compound Name | 3-[(2-hydroxy-3-octoxypropyl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 104580494 |
| Molecular Formula | C16H34N2O3 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | 3-[(2-hydroxy-3-octoxypropyl)amino]-3-methylbutanamide |
| SMILES | CCCCCCCCOCC(O)CNC(C)(C)CC(N)=O |
| InChI | InChI=1S/C16H34N2O3/c1-4-5-6-7-8-9-10-21-13-14(19)12-18-16(2,3)11-15(17)20/h14,18-19H,4-13H2,1-3H3,(H2,17,20) |
| InChIKey | FOEYIVLMQGSACL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|