C15H33NO3 — CID 103993473
3-[(3-hexoxy-2-hydroxypropyl)amino]-2,3-dimethylbutan-2-ol (PubChem CID 103993473) has the molecular formula C15H33NO3 and a molecular weight of 275.43 g/mol. Its IUPAC name is 3-[(3-hexoxy-2-hydroxypropyl)amino]-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[(3-hexoxy-2-hydroxypropyl)amino]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 103993473 |
| Molecular Formula | C15H33NO3 |
| Molecular Weight | 275.43 g/mol |
| Exact Mass | 275.25 |
| IUPAC Name | 3-[(3-hexoxy-2-hydroxypropyl)amino]-2,3-dimethylbutan-2-ol |
| SMILES | CCCCCCOCC(O)CNC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C15H33NO3/c1-6-7-8-9-10-19-12-13(17)11-16-14(2,3)15(4,5)18/h13,16-18H,6-12H2,1-5H3 |
| InChIKey | NHZIVLIGHWFMSB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|