C11H25N3O3 — CID 66178459
2-[2-(dimethylamino)ethylamino]-4,4-dimethoxy-2-methylbutanamide (PubChem CID 66178459) has the molecular formula C11H25N3O3 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylamino]-4,4-dimethoxy-2-methylbutanamide.
| Compound Name | 2-[2-(dimethylamino)ethylamino]-4,4-dimethoxy-2-methylbutanamide |
|---|---|
| PubChem CID | 66178459 |
| Molecular Formula | C11H25N3O3 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2-[2-(dimethylamino)ethylamino]-4,4-dimethoxy-2-methylbutanamide |
| SMILES | COC(CC(C)(NCCN(C)C)C(N)=O)OC |
| InChI | InChI=1S/C11H25N3O3/c1-11(10(12)15,8-9(16-4)17-5)13-6-7-14(2)3/h9,13H,6-8H2,1-5H3,(H2,12,15) |
| InChIKey | QKDHVSHDJLDUBN-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|