About 2-[2-(dimethylamino)ethylamino]-2,4-dimethylpentanoic acid
2-[2-(dimethylamino)ethylamino]-2,4-dimethylpentanoic acid (PubChem CID 61001781) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylamino]-2,4-dimethylpentanoic acid.
Analyze 2-[2-(dimethylamino)ethylamino]-2,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(dimethylamino)ethylamino]-2,4-dimethylpentanoic acid?
The IUPAC name of 2-[2-(dimethylamino)ethylamino]-2,4-dimethylpentanoic acid (CID 61001781) is 2-[2-(dimethylamino)ethylamino]-2,4-dimethylpentanoic acid.
What is the SMILES notation for 2-[2-(dimethylamino)ethylamino]-2,4-dimethylpentanoic acid?
The canonical SMILES for 2-[2-(dimethylamino)ethylamino]-2,4-dimethylpentanoic acid is CC(C)CC(C)(NCCN(C)C)C(=O)O.
What is the InChIKey of 2-[2-(dimethylamino)ethylamino]-2,4-dimethylpentanoic acid?
The InChIKey is QWCGABAPCIJRJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O2/c1-9(2)8-11(3,10(14)15)12-6-7-13(4)5/h9,12H,6-8H2,1-5H3,(H,14,15).
What are the key properties of 2-[2-(dimethylamino)ethylamino]-2,4-dimethylpentanoic acid?
2-[2-(dimethylamino)ethylamino]-2,4-dimethylpentanoic acid has a molecular weight of 216.32 g/mol, XLogP of 1.03, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(dimethylamino)ethylamino]-2,4-dimethylpentanoic acid is sourced from PubChem (CID 61001781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).