About methyl 2-[2-(dimethylamino)ethylamino]-4,4-dimethylpentanoate
methyl 2-[2-(dimethylamino)ethylamino]-4,4-dimethylpentanoate (PubChem CID 62950242) has the molecular formula C12H26N2O2
and a molecular weight of 230.35 g/mol. Its IUPAC name is methyl 2-[2-(dimethylamino)ethylamino]-4,4-dimethylpentanoate.
Analyze methyl 2-[2-(dimethylamino)ethylamino]-4,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(dimethylamino)ethylamino]-4,4-dimethylpentanoate?
The IUPAC name of methyl 2-[2-(dimethylamino)ethylamino]-4,4-dimethylpentanoate (CID 62950242) is methyl 2-[2-(dimethylamino)ethylamino]-4,4-dimethylpentanoate.
What is the SMILES notation for methyl 2-[2-(dimethylamino)ethylamino]-4,4-dimethylpentanoate?
The canonical SMILES for methyl 2-[2-(dimethylamino)ethylamino]-4,4-dimethylpentanoate is COC(=O)C(CC(C)(C)C)NCCN(C)C.
What is the InChIKey of methyl 2-[2-(dimethylamino)ethylamino]-4,4-dimethylpentanoate?
The InChIKey is UUUHSQYDHVWHFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O2/c1-12(2,3)9-10(11(15)16-6)13-7-8-14(4)5/h10,13H,7-9H2,1-6H3.
What are the key properties of methyl 2-[2-(dimethylamino)ethylamino]-4,4-dimethylpentanoate?
methyl 2-[2-(dimethylamino)ethylamino]-4,4-dimethylpentanoate has a molecular weight of 230.35 g/mol, XLogP of 1.12, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(dimethylamino)ethylamino]-4,4-dimethylpentanoate is sourced from PubChem (CID 62950242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).