C17H27BO4S — CID 154720614
ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-thiophen-2-ylpentanoate (PubChem CID 154720614) has the molecular formula C17H27BO4S and a molecular weight of 338.28 g/mol. Its IUPAC name is ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-thiophen-2-ylpentanoate.
| Compound Name | ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-thiophen-2-ylpentanoate |
|---|---|
| PubChem CID | 154720614 |
| Molecular Formula | C17H27BO4S |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-thiophen-2-ylpentanoate |
| SMILES | CCOC(=O)CCC(Cc1cccs1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H27BO4S/c1-6-20-15(19)10-9-13(12-14-8-7-11-23-14)18-21-16(2,3)17(4,5)22-18/h7-8,11,13H,6,9-10,12H2,1-5H3 |
| InChIKey | KRWFBBQEXCWLIA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|