C14H22BNO4S — CID 170817251
ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1,3-thiazol-2-yl)propanoate (PubChem CID 170817251) has the molecular formula C14H22BNO4S and a molecular weight of 311.21 g/mol. Its IUPAC name is ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1,3-thiazol-2-yl)propanoate.
| Compound Name | ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1,3-thiazol-2-yl)propanoate |
|---|---|
| PubChem CID | 170817251 |
| Molecular Formula | C14H22BNO4S |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1,3-thiazol-2-yl)propanoate |
| SMILES | CCOC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1nccs1 |
| InChI | InChI=1S/C14H22BNO4S/c1-6-18-11(17)9-10(12-16-7-8-21-12)15-19-13(2,3)14(4,5)20-15/h7-8,10H,6,9H2,1-5H3 |
| InChIKey | UOISODJIUVZZET-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|