C18H35BO4 — CID 102459214
octyl (3R)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoate (PubChem CID 102459214) has the molecular formula C18H35BO4 and a molecular weight of 326.29 g/mol. Its IUPAC name is octyl (3R)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoate.
| Compound Name | octyl (3R)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoate |
|---|---|
| PubChem CID | 102459214 |
| Molecular Formula | C18H35BO4 |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | octyl (3R)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoate |
| SMILES | CCCCCCCCOC(=O)C[C@@H](C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H35BO4/c1-7-8-9-10-11-12-13-21-16(20)14-15(2)19-22-17(3,4)18(5,6)23-19/h15H,7-14H2,1-6H3/t15-/m1/s1 |
| InChIKey | WJLZPVRYKNQINH-OAHLLOKOSA-N |
| XLogP | 4.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|