About CID 87119570
CID 87119570 (PubChem CID 87119570) has the molecular formula C20H40NaO3
and a molecular weight of 351.53 g/mol.
Molecular Properties
| Compound Name | CID 87119570 |
| PubChem CID | 87119570 |
| Molecular Formula | C20H40NaO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCCCCCCCCCCOC(=O)CO.[Na] |
| InChI | InChI=1S/C20H40O3.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-20(22)19-21;/h21H,2-19H2,1H3; |
| InChIKey | CWOQMGZNJJHINB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 87119570 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87119570?
The IUPAC name of CID 87119570 (CID 87119570) is not available.
What is the SMILES notation for CID 87119570?
The canonical SMILES for CID 87119570 is CCCCCCCCCCCCCCCCCCOC(=O)CO.[Na].
What is the InChIKey of CID 87119570?
The InChIKey is CWOQMGZNJJHINB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O3.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-20(22)19-21;/h21H,2-19H2,1H3;.
What are the key properties of CID 87119570?
CID 87119570 has a molecular weight of 351.53 g/mol, XLogP of 5.40, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87119570 is sourced from PubChem (CID 87119570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).