C21H44O6 — CID 159507020
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;tridecyl 2-hydroxyacetate (PubChem CID 159507020) has the molecular formula C21H44O6 and a molecular weight of 392.58 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;tridecyl 2-hydroxyacetate.
| Compound Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;tridecyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 159507020 |
| Molecular Formula | C21H44O6 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;tridecyl 2-hydroxyacetate |
| SMILES | CCC(CO)(CO)CO.CCCCCCCCCCCCCOC(=O)CO |
| InChI | InChI=1S/C15H30O3.C6H14O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-18-15(17)14-16;1-2-6(3-7,4-8)5-9/h16H,2-14H2,1H3;7-9H,2-5H2,1H3 |
| InChIKey | MACUVPBZSZGVBG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|