C18H29BCl4O6 — CID 175640375
ethyl (Z,2S,3S)-3-(dichloromethyl)-2-[2,2-dichloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-5-ethoxy-5-hydroxypent-4-enoate (PubChem CID 175640375) has the molecular formula C18H29BCl4O6 and a molecular weight of 494.05 g/mol. Its IUPAC name is ethyl (Z,2S,3S)-3-(dichloromethyl)-2-[2,2-dichloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-5-ethoxy-5-hydroxypent-4-enoate.
| Compound Name | ethyl (Z,2S,3S)-3-(dichloromethyl)-2-[2,2-dichloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-5-ethoxy-5-hydroxypent-4-enoate |
|---|---|
| PubChem CID | 175640375 |
| Molecular Formula | C18H29BCl4O6 |
| Molecular Weight | 494.05 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | ethyl (Z,2S,3S)-3-(dichloromethyl)-2-[2,2-dichloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-5-ethoxy-5-hydroxypent-4-enoate |
| SMILES | CCOC(=O)[C@@H](C(B1OC(C)(C)C(C)(C)O1)C(Cl)Cl)[C@H](/C=C(/O)OCC)C(Cl)Cl |
| InChI | InChI=1S/C18H29BCl4O6/c1-7-26-11(24)9-10(14(20)21)12(16(25)27-8-2)13(15(22)23)19-28-17(3,4)18(5,6)29-19/h9-10,12-15,24H,7-8H2,1-6H3/b11-9-/t10-,12+,13?/m0/s1 |
| InChIKey | YHLJFXRBCMUIOU-QODLATQNSA-N |
| XLogP | 5.29 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.05 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|