C22H30BClO6 — CID 102177888
diethyl 2-[(E)-2-(4-chlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]propanedioate (PubChem CID 102177888) has the molecular formula C22H30BClO6 and a molecular weight of 436.74 g/mol. Its IUPAC name is diethyl 2-[(E)-2-(4-chlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]propanedioate.
| Compound Name | diethyl 2-[(E)-2-(4-chlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 102177888 |
| Molecular Formula | C22H30BClO6 |
| Molecular Weight | 436.74 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | diethyl 2-[(E)-2-(4-chlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(C/C(=C\B1OC(C)(C)C(C)(C)O1)c1ccc(Cl)cc1)C(=O)OCC |
| InChI | InChI=1S/C22H30BClO6/c1-7-27-19(25)18(20(26)28-8-2)13-16(15-9-11-17(24)12-10-15)14-23-29-21(3,4)22(5,6)30-23/h9-12,14,18H,7-8,13H2,1-6H3/b16-14+ |
| InChIKey | MPDCFVKDONMPLU-JQIJEIRASA-N |
| XLogP | 4.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.74 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|