C22H34BClO4 — CID 154585613
[(4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl] 4-chlorobenzoate (PubChem CID 154585613) has the molecular formula C22H34BClO4 and a molecular weight of 408.78 g/mol. Its IUPAC name is [(4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl] 4-chlorobenzoate.
| Compound Name | [(4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 154585613 |
| Molecular Formula | C22H34BClO4 |
| Molecular Weight | 408.78 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | [(4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl] 4-chlorobenzoate |
| SMILES | CCCCC[C@@H](CCCOC(=O)c1ccc(Cl)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H34BClO4/c1-6-7-8-10-18(23-27-21(2,3)22(4,5)28-23)11-9-16-26-20(25)17-12-14-19(24)15-13-17/h12-15,18H,6-11,16H2,1-5H3/t18-/m0/s1 |
| InChIKey | LEKONJCPLGUPFN-SFHVURJKSA-N |
| XLogP | 6.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.78 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|