C35H45B2NO6 — CID 153297483
butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]anilino]benzoate (PubChem CID 153297483) has the molecular formula C35H45B2NO6 and a molecular weight of 597.37 g/mol. Its IUPAC name is butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]anilino]benzoate.
| Compound Name | butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]anilino]benzoate |
|---|---|
| PubChem CID | 153297483 |
| Molecular Formula | C35H45B2NO6 |
| Molecular Weight | 597.37 g/mol |
| Exact Mass | 597.34 |
| IUPAC Name | butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]anilino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C35H45B2NO6/c1-10-11-24-40-31(39)25-12-18-28(19-13-25)38(29-20-14-26(15-21-29)36-41-32(2,3)33(4,5)42-36)30-22-16-27(17-23-30)37-43-34(6,7)35(8,9)44-37/h12-23H,10-11,24H2,1-9H3 |
| InChIKey | BPLNJPHIJPMQCV-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.37 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|