C19H14Cl2O2 — CID 25260453
ethyl 5,5-bis(4-chlorophenyl)penta-2,3,4-trienoate (PubChem CID 25260453) has the molecular formula C19H14Cl2O2 and a molecular weight of 345.23 g/mol. Its IUPAC name is ethyl 5,5-bis(4-chlorophenyl)penta-2,3,4-trienoate.
| Compound Name | ethyl 5,5-bis(4-chlorophenyl)penta-2,3,4-trienoate |
|---|---|
| PubChem CID | 25260453 |
| Molecular Formula | C19H14Cl2O2 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | ethyl 5,5-bis(4-chlorophenyl)penta-2,3,4-trienoate |
| SMILES | CCOC(=O)C=C=C=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14Cl2O2/c1-2-23-19(22)5-3-4-18(14-6-10-16(20)11-7-14)15-8-12-17(21)13-9-15/h5-13H,2H2,1H3 |
| InChIKey | DHDIGINOORNJQI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|