C25H26Cl2O6 — CID 122213329
diethyl (4S,5S)-4-(4-chlorobenzoyl)-5-(4-chlorophenyl)-2,2-dimethyloxolane-3,3-dicarboxylate (PubChem CID 122213329) has the molecular formula C25H26Cl2O6 and a molecular weight of 493.38 g/mol. Its IUPAC name is diethyl (4S,5S)-4-(4-chlorobenzoyl)-5-(4-chlorophenyl)-2,2-dimethyloxolane-3,3-dicarboxylate.
| Compound Name | diethyl (4S,5S)-4-(4-chlorobenzoyl)-5-(4-chlorophenyl)-2,2-dimethyloxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 122213329 |
| Molecular Formula | C25H26Cl2O6 |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | diethyl (4S,5S)-4-(4-chlorobenzoyl)-5-(4-chlorophenyl)-2,2-dimethyloxolane-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](C(=O)c2ccc(Cl)cc2)[C@@H](c2ccc(Cl)cc2)OC1(C)C |
| InChI | InChI=1S/C25H26Cl2O6/c1-5-31-22(29)25(23(30)32-6-2)19(20(28)15-7-11-17(26)12-8-15)21(33-24(25,3)4)16-9-13-18(27)14-10-16/h7-14,19,21H,5-6H2,1-4H3/t19-,21-/m1/s1 |
| InChIKey | MIXWWPNOAZDJSO-TZIWHRDSSA-N |
| XLogP | 5.45 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|