C16H17ClO5 — CID 102086771
cis-diethyl (2S,3R)-2-(4-chlorophenyl)-3-formylcyclopropane-1,1-dicarboxylate (PubChem CID 102086771) has the molecular formula C16H17ClO5 and a molecular weight of 324.76 g/mol. Its IUPAC name is cis-diethyl (2S,3R)-2-(4-chlorophenyl)-3-formylcyclopropane-1,1-dicarboxylate.
| Compound Name | cis-diethyl (2S,3R)-2-(4-chlorophenyl)-3-formylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102086771 |
| Molecular Formula | C16H17ClO5 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | cis-diethyl (2S,3R)-2-(4-chlorophenyl)-3-formylcyclopropane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](C=O)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClO5/c1-3-21-14(19)16(15(20)22-4-2)12(9-18)13(16)10-5-7-11(17)8-6-10/h5-9,12-13H,3-4H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | ZOTWWHYTIKWVEO-CHWSQXEVSA-N |
| XLogP | 2.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|