C17H22ClNO4 — CID 132596186
diethyl (3S,5S)-3-(4-chlorophenyl)-5-methylpyrrolidine-2,2-dicarboxylate (PubChem CID 132596186) has the molecular formula C17H22ClNO4 and a molecular weight of 339.82 g/mol. Its IUPAC name is diethyl (3S,5S)-3-(4-chlorophenyl)-5-methylpyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl (3S,5S)-3-(4-chlorophenyl)-5-methylpyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 132596186 |
| Molecular Formula | C17H22ClNO4 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | diethyl (3S,5S)-3-(4-chlorophenyl)-5-methylpyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@@H](C)C[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClNO4/c1-4-22-15(20)17(16(21)23-5-2)14(10-11(3)19-17)12-6-8-13(18)9-7-12/h6-9,11,14,19H,4-5,10H2,1-3H3/t11-,14-/m0/s1 |
| InChIKey | UUDHKPDOMDIICF-FZMZJTMJSA-N |
| XLogP | 2.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|