C31H34Cl2N2O5 — CID 102034071
diethyl (2R,5S)-2,5-bis(4-chlorophenyl)-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]imidazolidine-4,4-dicarboxylate (PubChem CID 102034071) has the molecular formula C31H34Cl2N2O5 and a molecular weight of 585.53 g/mol. Its IUPAC name is diethyl (2R,5S)-2,5-bis(4-chlorophenyl)-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]imidazolidine-4,4-dicarboxylate.
| Compound Name | diethyl (2R,5S)-2,5-bis(4-chlorophenyl)-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]imidazolidine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 102034071 |
| Molecular Formula | C31H34Cl2N2O5 |
| Molecular Weight | 585.53 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | diethyl (2R,5S)-2,5-bis(4-chlorophenyl)-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]imidazolidine-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@@H](c2ccc(Cl)cc2)N(c2ccc(OC(C)(C)C)cc2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H34Cl2N2O5/c1-6-38-28(36)31(29(37)39-7-2)26(20-8-12-22(32)13-9-20)35(27(34-31)21-10-14-23(33)15-11-21)24-16-18-25(19-17-24)40-30(3,4)5/h8-19,26-27,34H,6-7H2,1-5H3/t26-,27+/m0/s1 |
| InChIKey | JCAAUWAHQCDWMP-RRPNLBNLSA-N |
| XLogP | 6.89 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.53 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|