C15H17ClO5 — CID 135025934
diethyl (4R)-4-(4-chlorophenyl)oxetane-2,2-dicarboxylate (PubChem CID 135025934) has the molecular formula C15H17ClO5 and a molecular weight of 312.75 g/mol. Its IUPAC name is diethyl (4R)-4-(4-chlorophenyl)oxetane-2,2-dicarboxylate.
| Compound Name | diethyl (4R)-4-(4-chlorophenyl)oxetane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 135025934 |
| Molecular Formula | C15H17ClO5 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | diethyl (4R)-4-(4-chlorophenyl)oxetane-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@H](c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C15H17ClO5/c1-3-19-13(17)15(14(18)20-4-2)9-12(21-15)10-5-7-11(16)8-6-10/h5-8,12H,3-4,9H2,1-2H3/t12-/m1/s1 |
| InChIKey | DVCDUHPAARBKQY-GFCCVEGCSA-N |
| XLogP | 2.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|