C17H21ClO3 — CID 71478128
ethyl 2-[(2R,6R)-2-(4-chlorophenyl)-4,6-dimethyl-2,3-dihydropyran-6-yl]acetate (PubChem CID 71478128) has the molecular formula C17H21ClO3 and a molecular weight of 308.81 g/mol. Its IUPAC name is ethyl 2-[(2R,6R)-2-(4-chlorophenyl)-4,6-dimethyl-2,3-dihydropyran-6-yl]acetate.
| Compound Name | ethyl 2-[(2R,6R)-2-(4-chlorophenyl)-4,6-dimethyl-2,3-dihydropyran-6-yl]acetate |
|---|---|
| PubChem CID | 71478128 |
| Molecular Formula | C17H21ClO3 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | ethyl 2-[(2R,6R)-2-(4-chlorophenyl)-4,6-dimethyl-2,3-dihydropyran-6-yl]acetate |
| SMILES | CCOC(=O)C[C@]1(C)C=C(C)C[C@H](c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C17H21ClO3/c1-4-20-16(19)11-17(3)10-12(2)9-15(21-17)13-5-7-14(18)8-6-13/h5-8,10,15H,4,9,11H2,1-3H3/t15-,17+/m1/s1 |
| InChIKey | DVQAFMZOLLJNKN-WBVHZDCISA-N |
| XLogP | 4.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|