C12H14ClNO2S — CID 12748111
ethyl (4R)-2-(4-chlorophenyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 12748111) has the molecular formula C12H14ClNO2S and a molecular weight of 271.77 g/mol. Its IUPAC name is ethyl (4R)-2-(4-chlorophenyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | ethyl (4R)-2-(4-chlorophenyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 12748111 |
| Molecular Formula | C12H14ClNO2S |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | ethyl (4R)-2-(4-chlorophenyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CSC(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C12H14ClNO2S/c1-2-16-12(15)10-7-17-11(14-10)8-3-5-9(13)6-4-8/h3-6,10-11,14H,2,7H2,1H3/t10-,11?/m0/s1 |
| InChIKey | HCDILEJIGQCDBH-VUWPPUDQSA-N |
| XLogP | 2.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |