C11H13NO2S — CID 14790914
methyl 2-phenyl-1,3-thiazolidine-4-carboxylate (PubChem CID 14790914) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is methyl 2-phenyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl 2-phenyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 14790914 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | methyl 2-phenyl-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)C1CSC(c2ccccc2)N1 |
| InChI | InChI=1S/C11H13NO2S/c1-14-11(13)9-7-15-10(12-9)8-5-3-2-4-6-8/h2-6,9-10,12H,7H2,1H3 |
| InChIKey | SGFAUQHDEFHPAQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |