C13H16FNO2S — CID 5170925
propan-2-yl 2-(4-fluorophenyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 5170925) has the molecular formula C13H16FNO2S and a molecular weight of 269.34 g/mol. Its IUPAC name is propan-2-yl 2-(4-fluorophenyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | propan-2-yl 2-(4-fluorophenyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 5170925 |
| Molecular Formula | C13H16FNO2S |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | propan-2-yl 2-(4-fluorophenyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CC(C)OC(=O)C1CSC(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C13H16FNO2S/c1-8(2)17-13(16)11-7-18-12(15-11)9-3-5-10(14)6-4-9/h3-6,8,11-12,15H,7H2,1-2H3 |
| InChIKey | OAKJMCGIXCXSQJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |