C12H15NO2S — CID 61146631
(4R)-2-(4-ethylphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 61146631) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is (4R)-2-(4-ethylphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-2-(4-ethylphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 61146631 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (4R)-2-(4-ethylphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCc1ccc(C2N[C@H](C(=O)O)CS2)cc1 |
| InChI | InChI=1S/C12H15NO2S/c1-2-8-3-5-9(6-4-8)11-13-10(7-16-11)12(14)15/h3-6,10-11,13H,2,7H2,1H3,(H,14,15)/t10-,11?/m0/s1 |
| InChIKey | OTYQAMRZSHKIGF-VUWPPUDQSA-N |
| XLogP | 2.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |