C10H13NO3S — CID 107773986
(4S)-2-(5-ethylfuran-2-yl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 107773986) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is (4S)-2-(5-ethylfuran-2-yl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4S)-2-(5-ethylfuran-2-yl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107773986 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | (4S)-2-(5-ethylfuran-2-yl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCc1ccc(C2N[C@@H](C(=O)O)CS2)o1 |
| InChI | InChI=1S/C10H13NO3S/c1-2-6-3-4-8(14-6)9-11-7(5-15-9)10(12)13/h3-4,7,9,11H,2,5H2,1H3,(H,12,13)/t7-,9?/m1/s1 |
| InChIKey | LRORRNOBOVTLFZ-YOXFSPIKSA-N |
| XLogP | 1.63 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |