C14H11ClN2O5S — CID 96835758
(2R,4R)-2-[5-(2-chloro-5-nitrophenyl)furan-2-yl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 96835758) has the molecular formula C14H11ClN2O5S and a molecular weight of 354.77 g/mol. Its IUPAC name is (2R,4R)-2-[5-(2-chloro-5-nitrophenyl)furan-2-yl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4R)-2-[5-(2-chloro-5-nitrophenyl)furan-2-yl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 96835758 |
| Molecular Formula | C14H11ClN2O5S |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | (2R,4R)-2-[5-(2-chloro-5-nitrophenyl)furan-2-yl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CS[C@H](c2ccc(-c3cc([N+](=O)[O-])ccc3Cl)o2)N1 |
| InChI | InChI=1S/C14H11ClN2O5S/c15-9-2-1-7(17(20)21)5-8(9)11-3-4-12(22-11)13-16-10(6-23-13)14(18)19/h1-5,10,13,16H,6H2,(H,18,19)/t10-,13+/m0/s1 |
| InChIKey | OQJRSCXJZPFHNL-GXFFZTMASA-N |
| XLogP | 3.30 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|