C15H14N2O5S — CID 7437855
(2R,4S)-2-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-1,3-thiazolidin-3-ium-4-carboxylate (PubChem CID 7437855) has the molecular formula C15H14N2O5S and a molecular weight of 334.35 g/mol. Its IUPAC name is (2R,4S)-2-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-1,3-thiazolidin-3-ium-4-carboxylate.
| Compound Name | (2R,4S)-2-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-1,3-thiazolidin-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 7437855 |
| Molecular Formula | C15H14N2O5S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (2R,4S)-2-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-1,3-thiazolidin-3-ium-4-carboxylate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1ccc([C@@H]2[NH2+][C@@H](C(=O)[O-])CS2)o1 |
| InChI | InChI=1S/C15H14N2O5S/c1-8-2-3-9(17(20)21)6-10(8)12-4-5-13(22-12)14-16-11(7-23-14)15(18)19/h2-6,11,14,16H,7H2,1H3,(H,18,19)/t11-,14-/m1/s1 |
| InChIKey | FWYBBEHLFYFMNJ-BXUZGUMPSA-N |
| XLogP | 0.59 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|