C19H17NO2S — CID 102101973
(4R)-2-[4-[2-(4-methylphenyl)ethynyl]phenyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 102101973) has the molecular formula C19H17NO2S and a molecular weight of 323.42 g/mol. Its IUPAC name is (4R)-2-[4-[2-(4-methylphenyl)ethynyl]phenyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-2-[4-[2-(4-methylphenyl)ethynyl]phenyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 102101973 |
| Molecular Formula | C19H17NO2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | (4R)-2-[4-[2-(4-methylphenyl)ethynyl]phenyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | Cc1ccc(C#Cc2ccc(C3N[C@H](C(=O)O)CS3)cc2)cc1 |
| InChI | InChI=1S/C19H17NO2S/c1-13-2-4-14(5-3-13)6-7-15-8-10-16(11-9-15)18-20-17(12-23-18)19(21)22/h2-5,8-11,17-18,20H,12H2,1H3,(H,21,22)/t17-,18?/m0/s1 |
| InChIKey | TZWNLUKVISUKIJ-ZENAZSQFSA-N |
| XLogP | 3.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|