C15H22N2OS — CID 143393756
N-butan-2-yl-2-(4-methylphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 143393756) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is N-butan-2-yl-2-(4-methylphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-butan-2-yl-2-(4-methylphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 143393756 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-butan-2-yl-2-(4-methylphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCC(C)NC(=O)C1CSC(c2ccc(C)cc2)N1 |
| InChI | InChI=1S/C15H22N2OS/c1-4-11(3)16-14(18)13-9-19-15(17-13)12-7-5-10(2)6-8-12/h5-8,11,13,15,17H,4,9H2,1-3H3,(H,16,18) |
| InChIKey | GRJGVGIFFRBXDQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |