C10H13N3OS — CID 3064949
2-phenyl-1,3-thiazolidine-4-carbohydrazide (PubChem CID 3064949) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-phenyl-1,3-thiazolidine-4-carbohydrazide.
| Compound Name | 2-phenyl-1,3-thiazolidine-4-carbohydrazide |
|---|---|
| PubChem CID | 3064949 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-phenyl-1,3-thiazolidine-4-carbohydrazide |
| SMILES | NNC(=O)C1CSC(c2ccccc2)N1 |
| InChI | InChI=1S/C10H13N3OS/c11-13-9(14)8-6-15-10(12-8)7-4-2-1-3-5-7/h1-5,8,10,12H,6,11H2,(H,13,14) |
| InChIKey | IEZDZMRGMSXTJU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|