C15H17Cl2N3OS — CID 14881601
N-phenyl-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide;dihydrochloride (PubChem CID 14881601) has the molecular formula C15H17Cl2N3OS and a molecular weight of 358.29 g/mol. Its IUPAC name is N-phenyl-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide;dihydrochloride.
| Compound Name | N-phenyl-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 14881601 |
| Molecular Formula | C15H17Cl2N3OS |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | N-phenyl-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccccc1)C1CSC(c2cccnc2)N1 |
| InChI | InChI=1S/C15H15N3OS.2ClH/c19-14(17-12-6-2-1-3-7-12)13-10-20-15(18-13)11-5-4-8-16-9-11;;/h1-9,13,15,18H,10H2,(H,17,19);2*1H |
| InChIKey | DRQLZWBIMSHWAS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |