C9H13Cl2N3OS — CID 19894077
2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide;dihydrochloride (PubChem CID 19894077) has the molecular formula C9H13Cl2N3OS and a molecular weight of 282.20 g/mol. Its IUPAC name is 2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide;dihydrochloride.
| Compound Name | 2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 19894077 |
| Molecular Formula | C9H13Cl2N3OS |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)C1CSC(c2cccnc2)N1 |
| InChI | InChI=1S/C9H11N3OS.2ClH/c10-8(13)7-5-14-9(12-7)6-2-1-3-11-4-6;;/h1-4,7,9,12H,5H2,(H2,10,13);2*1H |
| InChIKey | ISMZFUQJZSEZMM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |