C16H17N3O2S — CID 14881592
N-(3-methoxyphenyl)-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide (PubChem CID 14881592) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 14881592 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-(3-methoxyphenyl)-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide |
| SMILES | COc1cccc(NC(=O)C2CSC(c3cccnc3)N2)c1 |
| InChI | InChI=1S/C16H17N3O2S/c1-21-13-6-2-5-12(8-13)18-15(20)14-10-22-16(19-14)11-4-3-7-17-9-11/h2-9,14,16,19H,10H2,1H3,(H,18,20) |
| InChIKey | WHWZRZHGCYWNIC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |