C21H21N3O4 — CID 11878650
(1S,2R,3S,4R)-3-N-(3-methoxyphenyl)-2-N-(pyridin-3-ylmethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide (PubChem CID 11878650) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is (1S,2R,3S,4R)-3-N-(3-methoxyphenyl)-2-N-(pyridin-3-ylmethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide.
| Compound Name | (1S,2R,3S,4R)-3-N-(3-methoxyphenyl)-2-N-(pyridin-3-ylmethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 11878650 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (1S,2R,3S,4R)-3-N-(3-methoxyphenyl)-2-N-(pyridin-3-ylmethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
| SMILES | COc1cccc(NC(=O)[C@H]2[C@@H](C(=O)NCc3cccnc3)[C@@H]3C=C[C@H]2O3)c1 |
| InChI | InChI=1S/C21H21N3O4/c1-27-15-6-2-5-14(10-15)24-21(26)19-17-8-7-16(28-17)18(19)20(25)23-12-13-4-3-9-22-11-13/h2-11,16-19H,12H2,1H3,(H,23,25)(H,24,26)/t16-,17+,18-,19+/m0/s1 |
| InChIKey | COFKAGIAIFIYAK-ZSYWTGECSA-N |
| XLogP | 1.91 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|