(2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid

C10H10BrNO2S — CID 728223

IUPAC(2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid
SMILESO=C(O)[C@@H]1CS[C@@H](c2cccc(Br)c2)N1
InChIInChI=1S/C10H10BrNO2S/c11-7-3-1-2-6(4-7)9-12-8(5-15-9)10(13)14/h1-4,8-9,12H,5H2,(H,13,14)/t8-,9-/m0/s1
InChIKeyLZVZEQCJORCGOK-IUCAKERBSA-N
MW288.17 g/mol
LogP2.24
Rot. Bonds2

About (2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid

(2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 728223) has the molecular formula C10H10BrNO2S and a molecular weight of 288.17 g/mol. Its IUPAC name is (2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid.

Molecular Properties

Compound Name(2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid
PubChem CID728223
Molecular FormulaC10H10BrNO2S
Molecular Weight288.17 g/mol
Exact Mass286.96
IUPAC Name(2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid
SMILESO=C(O)[C@@H]1CS[C@@H](c2cccc(Br)c2)N1
InChIInChI=1S/C10H10BrNO2S/c11-7-3-1-2-6(4-7)9-12-8(5-15-9)10(13)14/h1-4,8-9,12H,5H2,(H,13,14)/t8-,9-/m0/s1
InChIKeyLZVZEQCJORCGOK-IUCAKERBSA-N
XLogP2.24
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.17
LogP ≤ 52.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid (CID 728223) is (2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid is O=C(O)[C@@H]1CS[C@@H](c2cccc(Br)c2)N1.
What is the InChIKey of (2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is LZVZEQCJORCGOK-IUCAKERBSA-N. The full InChI is InChI=1S/C10H10BrNO2S/c11-7-3-1-2-6(4-7)9-12-8(5-15-9)10(13)14/h1-4,8-9,12H,5H2,(H,13,14)/t8-,9-/m0/s1.
What are the key properties of (2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid?
(2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 288.17 g/mol, XLogP of 2.24, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 728223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).