C15H21NO2S — CID 11087152
(2R,4R)-2-(3-pentylphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 11087152) has the molecular formula C15H21NO2S and a molecular weight of 279.40 g/mol. Its IUPAC name is (2R,4R)-2-(3-pentylphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4R)-2-(3-pentylphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 11087152 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (2R,4R)-2-(3-pentylphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCCCc1cccc([C@@H]2N[C@H](C(=O)O)CS2)c1 |
| InChI | InChI=1S/C15H21NO2S/c1-2-3-4-6-11-7-5-8-12(9-11)14-16-13(10-19-14)15(17)18/h5,7-9,13-14,16H,2-4,6,10H2,1H3,(H,17,18)/t13-,14+/m0/s1 |
| InChIKey | QUFHZIYHJAKYTE-UONOGXRCSA-N |
| XLogP | 3.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|