C10H10ClNO2S — CID 40649091
(2R,4S)-2-(3-chlorophenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 40649091) has the molecular formula C10H10ClNO2S and a molecular weight of 243.72 g/mol. Its IUPAC name is (2R,4S)-2-(3-chlorophenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4S)-2-(3-chlorophenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 40649091 |
| Molecular Formula | C10H10ClNO2S |
| Molecular Weight | 243.72 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | (2R,4S)-2-(3-chlorophenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@H]1CS[C@H](c2cccc(Cl)c2)N1 |
| InChI | InChI=1S/C10H10ClNO2S/c11-7-3-1-2-6(4-7)9-12-8(5-15-9)10(13)14/h1-4,8-9,12H,5H2,(H,13,14)/t8-,9-/m1/s1 |
| InChIKey | ZIAXCRNTOFXJPM-RKDXNWHRSA-N |
| XLogP | 2.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.72 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |