C15H13NO5S — CID 7045930
(2R,4S)-2-[4-(furan-2-carbonyloxy)phenyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 7045930) has the molecular formula C15H13NO5S and a molecular weight of 319.34 g/mol. Its IUPAC name is (2R,4S)-2-[4-(furan-2-carbonyloxy)phenyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4S)-2-[4-(furan-2-carbonyloxy)phenyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 7045930 |
| Molecular Formula | C15H13NO5S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | (2R,4S)-2-[4-(furan-2-carbonyloxy)phenyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(Oc1ccc([C@@H]2N[C@@H](C(=O)O)CS2)cc1)c1ccco1 |
| InChI | InChI=1S/C15H13NO5S/c17-14(18)11-8-22-13(16-11)9-3-5-10(6-4-9)21-15(19)12-2-1-7-20-12/h1-7,11,13,16H,8H2,(H,17,18)/t11-,13-/m1/s1 |
| InChIKey | KMZOGWVAUXDYSK-DGCLKSJQSA-N |
| XLogP | 2.29 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|