C18H15NO6S — CID 7280950
(2S,4S)-2-[4-(1,3-benzodioxole-5-carbonyloxy)phenyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 7280950) has the molecular formula C18H15NO6S and a molecular weight of 373.39 g/mol. Its IUPAC name is (2S,4S)-2-[4-(1,3-benzodioxole-5-carbonyloxy)phenyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2S,4S)-2-[4-(1,3-benzodioxole-5-carbonyloxy)phenyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 7280950 |
| Molecular Formula | C18H15NO6S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | (2S,4S)-2-[4-(1,3-benzodioxole-5-carbonyloxy)phenyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(Oc1ccc([C@H]2N[C@@H](C(=O)O)CS2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15NO6S/c20-17(21)13-8-26-16(19-13)10-1-4-12(5-2-10)25-18(22)11-3-6-14-15(7-11)24-9-23-14/h1-7,13,16,19H,8-9H2,(H,20,21)/t13-,16+/m1/s1 |
| InChIKey | QYINCPWVXWEDGG-CJNGLKHVSA-N |
| XLogP | 2.42 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|