C17H13NO5S — CID 7741492
1,3-benzodioxol-5-yl (2S)-2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate (PubChem CID 7741492) has the molecular formula C17H13NO5S and a molecular weight of 343.36 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl (2S)-2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl (2S)-2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 7741492 |
| Molecular Formula | C17H13NO5S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 1,3-benzodioxol-5-yl (2S)-2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| SMILES | C[C@@H]1Sc2ccc(C(=O)Oc3ccc4c(c3)OCO4)cc2NC1=O |
| InChI | InChI=1S/C17H13NO5S/c1-9-16(19)18-12-6-10(2-5-15(12)24-9)17(20)23-11-3-4-13-14(7-11)22-8-21-13/h2-7,9H,8H2,1H3,(H,18,19)/t9-/m0/s1 |
| InChIKey | SCLRIUDEJKMONI-VIFPVBQESA-N |
| XLogP | 3.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|