C18H15NO4S — CID 42977549
phenacyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate (PubChem CID 42977549) has the molecular formula C18H15NO4S and a molecular weight of 341.39 g/mol. Its IUPAC name is phenacyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate.
| Compound Name | phenacyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 42977549 |
| Molecular Formula | C18H15NO4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | phenacyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| SMILES | CC1Sc2ccc(C(=O)OCC(=O)c3ccccc3)cc2NC1=O |
| InChI | InChI=1S/C18H15NO4S/c1-11-17(21)19-14-9-13(7-8-16(14)24-11)18(22)23-10-15(20)12-5-3-2-4-6-12/h2-9,11H,10H2,1H3,(H,19,21) |
| InChIKey | FYUYVIKSFZDNKR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |