C12H13NO2S2 — CID 116830131
2-methyl-6-(2-methylsulfanylacetyl)-4H-1,4-benzothiazin-3-one (PubChem CID 116830131) has the molecular formula C12H13NO2S2 and a molecular weight of 267.38 g/mol. Its IUPAC name is 2-methyl-6-(2-methylsulfanylacetyl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-methyl-6-(2-methylsulfanylacetyl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116830131 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 2-methyl-6-(2-methylsulfanylacetyl)-4H-1,4-benzothiazin-3-one |
| SMILES | CSCC(=O)c1ccc2c(c1)NC(=O)C(C)S2 |
| InChI | InChI=1S/C12H13NO2S2/c1-7-12(15)13-9-5-8(10(14)6-16-2)3-4-11(9)17-7/h3-5,7H,6H2,1-2H3,(H,13,15) |
| InChIKey | WJSDDDNLOYSYQG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |