C18H16N2O4S — CID 26683762
(4-acetamidophenyl) (2S)-2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate (PubChem CID 26683762) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is (4-acetamidophenyl) (2S)-2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate.
| Compound Name | (4-acetamidophenyl) (2S)-2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 26683762 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (4-acetamidophenyl) (2S)-2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2ccc3c(c2)NC(=O)[C@H](C)S3)cc1 |
| InChI | InChI=1S/C18H16N2O4S/c1-10-17(22)20-15-9-12(3-8-16(15)25-10)18(23)24-14-6-4-13(5-7-14)19-11(2)21/h3-10H,1-2H3,(H,19,21)(H,20,22)/t10-/m0/s1 |
| InChIKey | MHQIIRNZWYDEEI-JTQLQIEISA-N |
| XLogP | 3.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|