C10H9BrN2O2S — CID 115193305
N-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)carbamoyl bromide (PubChem CID 115193305) has the molecular formula C10H9BrN2O2S and a molecular weight of 301.17 g/mol. Its IUPAC name is N-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)carbamoyl bromide.
| Compound Name | N-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)carbamoyl bromide |
|---|---|
| PubChem CID | 115193305 |
| Molecular Formula | C10H9BrN2O2S |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | N-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)carbamoyl bromide |
| SMILES | CC1Sc2ccc(NC(=O)Br)cc2NC1=O |
| InChI | InChI=1S/C10H9BrN2O2S/c1-5-9(14)13-7-4-6(12-10(11)15)2-3-8(7)16-5/h2-5H,1H3,(H,12,15)(H,13,14) |
| InChIKey | KDKRCMOKSADTDA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|