C15H11NO5 — CID 929919
[4-(2,5-dioxopyrrolidin-1-yl)phenyl] furan-2-carboxylate (PubChem CID 929919) has the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. Its IUPAC name is [4-(2,5-dioxopyrrolidin-1-yl)phenyl] furan-2-carboxylate.
| Compound Name | [4-(2,5-dioxopyrrolidin-1-yl)phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 929919 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | [4-(2,5-dioxopyrrolidin-1-yl)phenyl] furan-2-carboxylate |
| SMILES | O=C(Oc1ccc(N2C(=O)CCC2=O)cc1)c1ccco1 |
| InChI | InChI=1S/C15H11NO5/c17-13-7-8-14(18)16(13)10-3-5-11(6-4-10)21-15(19)12-2-1-9-20-12/h1-6,9H,7-8H2 |
| InChIKey | HAZAUKRJIIRAEV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|