C19H17NO5 — CID 4256331
[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] furan-2-carboxylate (PubChem CID 4256331) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is [4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] furan-2-carboxylate.
| Compound Name | [4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 4256331 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | [4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] furan-2-carboxylate |
| SMILES | O=C(Oc1ccc(N2C(=O)C3CCCCC3C2=O)cc1)c1ccco1 |
| InChI | InChI=1S/C19H17NO5/c21-17-14-4-1-2-5-15(14)18(22)20(17)12-7-9-13(10-8-12)25-19(23)16-6-3-11-24-16/h3,6-11,14-15H,1-2,4-5H2 |
| InChIKey | MZJAKPXNNPCYTH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|