C19H19NO5S — CID 7280010
(2R,4S)-2-(4-benzoyloxy-3-ethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 7280010) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is (2R,4S)-2-(4-benzoyloxy-3-ethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4S)-2-(4-benzoyloxy-3-ethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 7280010 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | (2R,4S)-2-(4-benzoyloxy-3-ethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCOc1cc([C@@H]2N[C@@H](C(=O)O)CS2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19NO5S/c1-2-24-16-10-13(17-20-14(11-26-17)18(21)22)8-9-15(16)25-19(23)12-6-4-3-5-7-12/h3-10,14,17,20H,2,11H2,1H3,(H,21,22)/t14-,17-/m1/s1 |
| InChIKey | VMUSDXDBXCYWMS-RHSMWYFYSA-N |
| XLogP | 3.09 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|